C18H27BO6 — CID 170816466
methyl 3-(2,3-dimethoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816466) has the molecular formula C18H27BO6 and a molecular weight of 350.22 g/mol. Its IUPAC name is methyl 3-(2,3-dimethoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | methyl 3-(2,3-dimethoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816466 |
| Molecular Formula | C18H27BO6 |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | methyl 3-(2,3-dimethoxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | COC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1cccc(OC)c1OC |
| InChI | InChI=1S/C18H27BO6/c1-17(2)18(3,4)25-19(24-17)13(11-15(20)22-6)12-9-8-10-14(21-5)16(12)23-7/h8-10,13H,11H2,1-7H3 |
| InChIKey | YKPYTXGMBLJGTM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|