C18H25BO6 — CID 170816469
methyl 2-[3-methoxy-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzoate (PubChem CID 170816469) has the molecular formula C18H25BO6 and a molecular weight of 348.20 g/mol. Its IUPAC name is methyl 2-[3-methoxy-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzoate.
| Compound Name | methyl 2-[3-methoxy-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzoate |
|---|---|
| PubChem CID | 170816469 |
| Molecular Formula | C18H25BO6 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | methyl 2-[3-methoxy-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]benzoate |
| SMILES | COC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1ccccc1C(=O)OC |
| InChI | InChI=1S/C18H25BO6/c1-17(2)18(3,4)25-19(24-17)14(11-15(20)22-5)12-9-7-8-10-13(12)16(21)23-6/h7-10,14H,11H2,1-6H3 |
| InChIKey | IIZIUAKSQHOXNR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|