C17H24BIO4 — CID 170816880
ethyl 3-(2-iodophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816880) has the molecular formula C17H24BIO4 and a molecular weight of 430.09 g/mol. Its IUPAC name is ethyl 3-(2-iodophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | ethyl 3-(2-iodophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816880 |
| Molecular Formula | C17H24BIO4 |
| Molecular Weight | 430.09 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | ethyl 3-(2-iodophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | CCOC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1ccccc1I |
| InChI | InChI=1S/C17H24BIO4/c1-6-21-15(20)11-13(12-9-7-8-10-14(12)19)18-22-16(2,3)17(4,5)23-18/h7-10,13H,6,11H2,1-5H3 |
| InChIKey | ULYDIXBXXMXKHB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.09 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|