C19H29BO5 — CID 170816799
ethyl 3-(2-methoxy-4-methylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816799) has the molecular formula C19H29BO5 and a molecular weight of 348.25 g/mol. Its IUPAC name is ethyl 3-(2-methoxy-4-methylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | ethyl 3-(2-methoxy-4-methylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816799 |
| Molecular Formula | C19H29BO5 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | ethyl 3-(2-methoxy-4-methylphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | CCOC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1ccc(C)cc1OC |
| InChI | InChI=1S/C19H29BO5/c1-8-23-17(21)12-15(14-10-9-13(2)11-16(14)22-7)20-24-18(3,4)19(5,6)25-20/h9-11,15H,8,12H2,1-7H3 |
| InChIKey | SMXGFMLFTUYMEO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|