C19H27BO7 — CID 170816859
2-[2-[3-ethoxy-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]phenoxy]acetic acid (PubChem CID 170816859) has the molecular formula C19H27BO7 and a molecular weight of 378.23 g/mol. Its IUPAC name is 2-[2-[3-ethoxy-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[3-ethoxy-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 170816859 |
| Molecular Formula | C19H27BO7 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-[2-[3-ethoxy-3-oxo-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]phenoxy]acetic acid |
| SMILES | CCOC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1ccccc1OCC(=O)O |
| InChI | InChI=1S/C19H27BO7/c1-6-24-17(23)11-14(20-26-18(2,3)19(4,5)27-20)13-9-7-8-10-15(13)25-12-16(21)22/h7-10,14H,6,11-12H2,1-5H3,(H,21,22) |
| InChIKey | RJYHBWFYCQFATE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|