C15H23BO4S — CID 170817121
ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thiophen-2-ylpropanoate (PubChem CID 170817121) has the molecular formula C15H23BO4S and a molecular weight of 310.22 g/mol. Its IUPAC name is ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thiophen-2-ylpropanoate.
| Compound Name | ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 170817121 |
| Molecular Formula | C15H23BO4S |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thiophen-2-ylpropanoate |
| SMILES | CCOC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1cccs1 |
| InChI | InChI=1S/C15H23BO4S/c1-6-18-13(17)10-11(12-8-7-9-21-12)16-19-14(2,3)15(4,5)20-16/h7-9,11H,6,10H2,1-5H3 |
| InChIKey | MXDSLEGUJZBROH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|