C17H25BO6 — CID 170816926
ethyl 3-(3,4-dihydroxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816926) has the molecular formula C17H25BO6 and a molecular weight of 336.19 g/mol. Its IUPAC name is ethyl 3-(3,4-dihydroxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | ethyl 3-(3,4-dihydroxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816926 |
| Molecular Formula | C17H25BO6 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | ethyl 3-(3,4-dihydroxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | CCOC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H25BO6/c1-6-22-15(21)10-12(11-7-8-13(19)14(20)9-11)18-23-16(2,3)17(4,5)24-18/h7-9,12,19-20H,6,10H2,1-5H3 |
| InChIKey | WIHKFGFUZLIOCL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|