C17H24BFO5 — CID 170817018
ethyl 3-(3-fluoro-4-hydroxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170817018) has the molecular formula C17H24BFO5 and a molecular weight of 338.18 g/mol. Its IUPAC name is ethyl 3-(3-fluoro-4-hydroxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | ethyl 3-(3-fluoro-4-hydroxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170817018 |
| Molecular Formula | C17H24BFO5 |
| Molecular Weight | 338.18 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | ethyl 3-(3-fluoro-4-hydroxyphenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | CCOC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C17H24BFO5/c1-6-22-15(21)10-12(11-7-8-14(20)13(19)9-11)18-23-16(2,3)17(4,5)24-18/h7-9,12,20H,6,10H2,1-5H3 |
| InChIKey | VMYMMZCPLATOOF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.18 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|