C17H23BFIO4 — CID 170816967
ethyl 3-(2-fluoro-6-iodophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816967) has the molecular formula C17H23BFIO4 and a molecular weight of 448.08 g/mol. Its IUPAC name is ethyl 3-(2-fluoro-6-iodophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | ethyl 3-(2-fluoro-6-iodophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816967 |
| Molecular Formula | C17H23BFIO4 |
| Molecular Weight | 448.08 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | ethyl 3-(2-fluoro-6-iodophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | CCOC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1c(F)cccc1I |
| InChI | InChI=1S/C17H23BFIO4/c1-6-22-14(21)10-11(15-12(19)8-7-9-13(15)20)18-23-16(2,3)17(4,5)24-18/h7-9,11H,6,10H2,1-5H3 |
| InChIKey | FIMHTYFCWAMSBC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.08 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|