C20H31BO4 — CID 170816762
ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trimethylphenyl)propanoate (PubChem CID 170816762) has the molecular formula C20H31BO4 and a molecular weight of 346.28 g/mol. Its IUPAC name is ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trimethylphenyl)propanoate.
| Compound Name | ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trimethylphenyl)propanoate |
|---|---|
| PubChem CID | 170816762 |
| Molecular Formula | C20H31BO4 |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | ethyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(2,4,6-trimethylphenyl)propanoate |
| SMILES | CCOC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C20H31BO4/c1-9-23-17(22)12-16(18-14(3)10-13(2)11-15(18)4)21-24-19(5,6)20(7,8)25-21/h10-11,16H,9,12H2,1-8H3 |
| InChIKey | GWQHAGOYCOJSDS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|