C17H24BBr2NO4 — CID 170816730
ethyl 3-(2-amino-3,5-dibromophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (PubChem CID 170816730) has the molecular formula C17H24BBr2NO4 and a molecular weight of 477.00 g/mol. Its IUPAC name is ethyl 3-(2-amino-3,5-dibromophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate.
| Compound Name | ethyl 3-(2-amino-3,5-dibromophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
|---|---|
| PubChem CID | 170816730 |
| Molecular Formula | C17H24BBr2NO4 |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | ethyl 3-(2-amino-3,5-dibromophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| SMILES | CCOC(=O)CC(B1OC(C)(C)C(C)(C)O1)c1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C17H24BBr2NO4/c1-6-23-14(22)9-12(11-7-10(19)8-13(20)15(11)21)18-24-16(2,3)17(4,5)25-18/h7-8,12H,6,9,21H2,1-5H3 |
| InChIKey | HIYGJNXZLPIGGX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|