C11H15Br2ClN2O2 — CID 171219035
ethyl (3S)-3-amino-3-(2-amino-3,5-dibromophenyl)propanoate;hydrochloride (PubChem CID 171219035) has the molecular formula C11H15Br2ClN2O2 and a molecular weight of 402.51 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(2-amino-3,5-dibromophenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(2-amino-3,5-dibromophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171219035 |
| Molecular Formula | C11H15Br2ClN2O2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 399.92 |
| IUPAC Name | ethyl (3S)-3-amino-3-(2-amino-3,5-dibromophenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C[C@H](N)c1cc(Br)cc(Br)c1N.Cl |
| InChI | InChI=1S/C11H14Br2N2O2.ClH/c1-2-17-10(16)5-9(14)7-3-6(12)4-8(13)11(7)15;/h3-4,9H,2,5,14-15H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | CBXXSGOCSKUMII-FVGYRXGTSA-N |
| XLogP | 3.17 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|