C11H14BrClN2O5 — CID 171234427
ethyl (3S)-3-amino-3-(5-bromo-2-hydroxy-3-nitrophenyl)propanoate;hydrochloride (PubChem CID 171234427) has the molecular formula C11H14BrClN2O5 and a molecular weight of 369.60 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(5-bromo-2-hydroxy-3-nitrophenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(5-bromo-2-hydroxy-3-nitrophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171234427 |
| Molecular Formula | C11H14BrClN2O5 |
| Molecular Weight | 369.60 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | ethyl (3S)-3-amino-3-(5-bromo-2-hydroxy-3-nitrophenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C[C@H](N)c1cc(Br)cc([N+](=O)[O-])c1O.Cl |
| InChI | InChI=1S/C11H13BrN2O5.ClH/c1-2-19-10(15)5-8(13)7-3-6(12)4-9(11(7)16)14(17)18;/h3-4,8,16H,2,5,13H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | XEGKGLHDXNQSNG-QRPNPIFTSA-N |
| XLogP | 2.44 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.60 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|