C10H12ClFN2O5 — CID 171255458
methyl (3S)-3-amino-3-(5-fluoro-2-hydroxy-3-nitrophenyl)propanoate;hydrochloride (PubChem CID 171255458) has the molecular formula C10H12ClFN2O5 and a molecular weight of 294.67 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(5-fluoro-2-hydroxy-3-nitrophenyl)propanoate;hydrochloride.
| Compound Name | methyl (3S)-3-amino-3-(5-fluoro-2-hydroxy-3-nitrophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171255458 |
| Molecular Formula | C10H12ClFN2O5 |
| Molecular Weight | 294.67 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | methyl (3S)-3-amino-3-(5-fluoro-2-hydroxy-3-nitrophenyl)propanoate;hydrochloride |
| SMILES | COC(=O)C[C@H](N)c1cc(F)cc([N+](=O)[O-])c1O.Cl |
| InChI | InChI=1S/C10H11FN2O5.ClH/c1-18-9(14)4-7(12)6-2-5(11)3-8(10(6)15)13(16)17;/h2-3,7,15H,4,12H2,1H3;1H/t7-;/m0./s1 |
| InChIKey | JZAVPGBNOKMOPC-FJXQXJEOSA-N |
| XLogP | 1.42 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.67 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|