C9H12Br2N2 — CID 130700951
2-[(1S)-1-aminopropyl]-4,6-dibromoaniline (PubChem CID 130700951) has the molecular formula C9H12Br2N2 and a molecular weight of 308.02 g/mol. Its IUPAC name is 2-[(1S)-1-aminopropyl]-4,6-dibromoaniline.
| Compound Name | 2-[(1S)-1-aminopropyl]-4,6-dibromoaniline |
|---|---|
| PubChem CID | 130700951 |
| Molecular Formula | C9H12Br2N2 |
| Molecular Weight | 308.02 g/mol |
| Exact Mass | 305.94 |
| IUPAC Name | 2-[(1S)-1-aminopropyl]-4,6-dibromoaniline |
| SMILES | CC[C@H](N)c1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C9H12Br2N2/c1-2-8(12)6-3-5(10)4-7(11)9(6)13/h3-4,8H,2,12-13H2,1H3/t8-/m0/s1 |
| InChIKey | ZOUVTYKDSGKOAA-QMMMGPOBSA-N |
| XLogP | 3.20 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.02 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|