C18H29Br2N — CID 166959193
2,4-dibromo-6-dodecan-5-ylaniline (PubChem CID 166959193) has the molecular formula C18H29Br2N and a molecular weight of 419.25 g/mol. Its IUPAC name is 2,4-dibromo-6-dodecan-5-ylaniline.
| Compound Name | 2,4-dibromo-6-dodecan-5-ylaniline |
|---|---|
| PubChem CID | 166959193 |
| Molecular Formula | C18H29Br2N |
| Molecular Weight | 419.25 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 2,4-dibromo-6-dodecan-5-ylaniline |
| SMILES | CCCCCCCC(CCCC)c1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C18H29Br2N/c1-3-5-7-8-9-11-14(10-6-4-2)16-12-15(19)13-17(20)18(16)21/h12-14H,3-11,21H2,1-2H3 |
| InChIKey | HISQHQUUEOKPKM-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.25 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|