C15H25Br2Cl2N3 — CID 171307375
2,4-dibromo-6-[(1R)-1-piperazin-1-ylpentyl]aniline;dihydrochloride (PubChem CID 171307375) has the molecular formula C15H25Br2Cl2N3 and a molecular weight of 478.10 g/mol. Its IUPAC name is 2,4-dibromo-6-[(1R)-1-piperazin-1-ylpentyl]aniline;dihydrochloride.
| Compound Name | 2,4-dibromo-6-[(1R)-1-piperazin-1-ylpentyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 171307375 |
| Molecular Formula | C15H25Br2Cl2N3 |
| Molecular Weight | 478.10 g/mol |
| Exact Mass | 474.98 |
| IUPAC Name | 2,4-dibromo-6-[(1R)-1-piperazin-1-ylpentyl]aniline;dihydrochloride |
| SMILES | CCCC[C@H](c1cc(Br)cc(Br)c1N)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H23Br2N3.2ClH/c1-2-3-4-14(20-7-5-19-6-8-20)12-9-11(16)10-13(17)15(12)18;;/h9-10,14,19H,2-8,18H2,1H3;2*1H/t14-;;/m1../s1 |
| InChIKey | UCQBLFVFZPFIID-FMOMHUKBSA-N |
| XLogP | 4.77 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.10 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|