C13H18Br2Cl2F3N3 — CID 171303349
2,4-dibromo-6-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]aniline;dihydrochloride (PubChem CID 171303349) has the molecular formula C13H18Br2Cl2F3N3 and a molecular weight of 504.02 g/mol. Its IUPAC name is 2,4-dibromo-6-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]aniline;dihydrochloride.
| Compound Name | 2,4-dibromo-6-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 171303349 |
| Molecular Formula | C13H18Br2Cl2F3N3 |
| Molecular Weight | 504.02 g/mol |
| Exact Mass | 500.92 |
| IUPAC Name | 2,4-dibromo-6-[(1R)-3,3,3-trifluoro-1-piperazin-1-ylpropyl]aniline;dihydrochloride |
| SMILES | Cl.Cl.Nc1c(Br)cc(Br)cc1[C@@H](CC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C13H16Br2F3N3.2ClH/c14-8-5-9(12(19)10(15)6-8)11(7-13(16,17)18)21-3-1-20-2-4-21;;/h5-6,11,20H,1-4,7,19H2;2*1H/t11-;;/m1../s1 |
| InChIKey | GVPZNBLNSFZGJZ-NVJADKKVSA-N |
| XLogP | 4.54 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.02 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|