C16H27Br2Cl2N3 — CID 171309906
2,4-dibromo-6-[(1S)-4-methyl-1-piperazin-1-ylpentyl]aniline;dihydrochloride (PubChem CID 171309906) has the molecular formula C16H27Br2Cl2N3 and a molecular weight of 492.13 g/mol. Its IUPAC name is 2,4-dibromo-6-[(1S)-4-methyl-1-piperazin-1-ylpentyl]aniline;dihydrochloride.
| Compound Name | 2,4-dibromo-6-[(1S)-4-methyl-1-piperazin-1-ylpentyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 171309906 |
| Molecular Formula | C16H27Br2Cl2N3 |
| Molecular Weight | 492.13 g/mol |
| Exact Mass | 488.99 |
| IUPAC Name | 2,4-dibromo-6-[(1S)-4-methyl-1-piperazin-1-ylpentyl]aniline;dihydrochloride |
| SMILES | CC(C)CC[C@@H](c1cc(Br)cc(Br)c1N)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H25Br2N3.2ClH/c1-11(2)3-4-15(21-7-5-20-6-8-21)13-9-12(17)10-14(18)16(13)19;;/h9-11,15,20H,3-8,19H2,1-2H3;2*1H/t15-;;/m0../s1 |
| InChIKey | PNXVNDXMWUTQNP-CKUXDGONSA-N |
| XLogP | 5.02 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.13 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|