C14H20Br2Cl2F3N3 — CID 171302387
2,4-dibromo-6-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]aniline;dihydrochloride (PubChem CID 171302387) has the molecular formula C14H20Br2Cl2F3N3 and a molecular weight of 518.04 g/mol. Its IUPAC name is 2,4-dibromo-6-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]aniline;dihydrochloride.
| Compound Name | 2,4-dibromo-6-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 171302387 |
| Molecular Formula | C14H20Br2Cl2F3N3 |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 514.94 |
| IUPAC Name | 2,4-dibromo-6-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]aniline;dihydrochloride |
| SMILES | Cl.Cl.Nc1c(Br)cc(Br)cc1[C@H](CCC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C14H18Br2F3N3.2ClH/c15-9-7-10(13(20)11(16)8-9)12(1-2-14(17,18)19)22-5-3-21-4-6-22;;/h7-8,12,21H,1-6,20H2;2*1H/t12-;;/m0../s1 |
| InChIKey | GBTDABJTVWAKTC-LTCKWSDVSA-N |
| XLogP | 4.93 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|