C11H18Br2ClN3 — CID 171218992
(1S)-1-(2-amino-3,5-dibromophenyl)pentane-1,5-diamine;hydrochloride (PubChem CID 171218992) has the molecular formula C11H18Br2ClN3 and a molecular weight of 387.55 g/mol. Its IUPAC name is (1S)-1-(2-amino-3,5-dibromophenyl)pentane-1,5-diamine;hydrochloride.
| Compound Name | (1S)-1-(2-amino-3,5-dibromophenyl)pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171218992 |
| Molecular Formula | C11H18Br2ClN3 |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | (1S)-1-(2-amino-3,5-dibromophenyl)pentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@H](N)c1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C11H17Br2N3.ClH/c12-7-5-8(11(16)9(13)6-7)10(15)3-1-2-4-14;/h5-6,10H,1-4,14-16H2;1H/t10-;/m0./s1 |
| InChIKey | FSXNEHVRGLMTNL-PPHPATTJSA-N |
| XLogP | 3.34 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|