C9H10Br2ClN3 — CID 171260301
(3R)-3-amino-3-(2-amino-3,5-dibromophenyl)propanenitrile;hydrochloride (PubChem CID 171260301) has the molecular formula C9H10Br2ClN3 and a molecular weight of 355.46 g/mol. Its IUPAC name is (3R)-3-amino-3-(2-amino-3,5-dibromophenyl)propanenitrile;hydrochloride.
| Compound Name | (3R)-3-amino-3-(2-amino-3,5-dibromophenyl)propanenitrile;hydrochloride |
|---|---|
| PubChem CID | 171260301 |
| Molecular Formula | C9H10Br2ClN3 |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 352.89 |
| IUPAC Name | (3R)-3-amino-3-(2-amino-3,5-dibromophenyl)propanenitrile;hydrochloride |
| SMILES | Cl.N#CC[C@@H](N)c1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C9H9Br2N3.ClH/c10-5-3-6(8(13)1-2-12)9(14)7(11)4-5;/h3-4,8H,1,13-14H2;1H/t8-;/m1./s1 |
| InChIKey | WZKZCWVNSWHGNK-DDWIOCJRSA-N |
| XLogP | 3.13 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|