C11H14Br2N2 — CID 171219023
2-[(1S)-1-aminopent-4-enyl]-4,6-dibromoaniline (PubChem CID 171219023) has the molecular formula C11H14Br2N2 and a molecular weight of 334.06 g/mol. Its IUPAC name is 2-[(1S)-1-aminopent-4-enyl]-4,6-dibromoaniline.
| Compound Name | 2-[(1S)-1-aminopent-4-enyl]-4,6-dibromoaniline |
|---|---|
| PubChem CID | 171219023 |
| Molecular Formula | C11H14Br2N2 |
| Molecular Weight | 334.06 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 2-[(1S)-1-aminopent-4-enyl]-4,6-dibromoaniline |
| SMILES | C=CCC[C@H](N)c1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C11H14Br2N2/c1-2-3-4-10(14)8-5-7(12)6-9(13)11(8)15/h2,5-6,10H,1,3-4,14-15H2/t10-/m0/s1 |
| InChIKey | BJDDUZBYHANMJS-JTQLQIEISA-N |
| XLogP | 3.76 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.06 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|