C14H19Br2N — CID 107947175
1-(2,4-dibromophenyl)oct-7-en-1-amine (PubChem CID 107947175) has the molecular formula C14H19Br2N and a molecular weight of 361.12 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)oct-7-en-1-amine.
| Compound Name | 1-(2,4-dibromophenyl)oct-7-en-1-amine |
|---|---|
| PubChem CID | 107947175 |
| Molecular Formula | C14H19Br2N |
| Molecular Weight | 361.12 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 1-(2,4-dibromophenyl)oct-7-en-1-amine |
| SMILES | C=CCCCCCC(N)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H19Br2N/c1-2-3-4-5-6-7-14(17)12-9-8-11(15)10-13(12)16/h2,8-10,14H,1,3-7,17H2 |
| InChIKey | KMWUMULEFZIPCS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.12 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|