C12H14Br2O — CID 107947534
1-(2,4-dibromophenyl)hex-5-en-1-ol (PubChem CID 107947534) has the molecular formula C12H14Br2O and a molecular weight of 334.05 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)hex-5-en-1-ol.
| Compound Name | 1-(2,4-dibromophenyl)hex-5-en-1-ol |
|---|---|
| PubChem CID | 107947534 |
| Molecular Formula | C12H14Br2O |
| Molecular Weight | 334.05 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | 1-(2,4-dibromophenyl)hex-5-en-1-ol |
| SMILES | C=CCCCC(O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H14Br2O/c1-2-3-4-5-12(15)10-7-6-9(13)8-11(10)14/h2,6-8,12,15H,1,3-5H2 |
| InChIKey | WYZDJIRPXCNKSO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.05 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|