C10H16Br2ClN3 — CID 171199463
(1R)-1-(2-amino-3,5-dibromophenyl)butane-1,4-diamine;hydrochloride (PubChem CID 171199463) has the molecular formula C10H16Br2ClN3 and a molecular weight of 373.52 g/mol. Its IUPAC name is (1R)-1-(2-amino-3,5-dibromophenyl)butane-1,4-diamine;hydrochloride.
| Compound Name | (1R)-1-(2-amino-3,5-dibromophenyl)butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171199463 |
| Molecular Formula | C10H16Br2ClN3 |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | (1R)-1-(2-amino-3,5-dibromophenyl)butane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCC[C@@H](N)c1cc(Br)cc(Br)c1N |
| InChI | InChI=1S/C10H15Br2N3.ClH/c11-6-4-7(9(14)2-1-3-13)10(15)8(12)5-6;/h4-5,9H,1-3,13-15H2;1H/t9-;/m1./s1 |
| InChIKey | HTTJOYMXWNPIBT-SBSPUUFOSA-N |
| XLogP | 2.95 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|