C11H16BrFN2 — CID 171224532
(1S)-1-(5-bromo-2-fluoro-3-methylphenyl)butane-1,4-diamine (PubChem CID 171224532) has the molecular formula C11H16BrFN2 and a molecular weight of 275.16 g/mol. Its IUPAC name is (1S)-1-(5-bromo-2-fluoro-3-methylphenyl)butane-1,4-diamine.
| Compound Name | (1S)-1-(5-bromo-2-fluoro-3-methylphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 171224532 |
| Molecular Formula | C11H16BrFN2 |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | (1S)-1-(5-bromo-2-fluoro-3-methylphenyl)butane-1,4-diamine |
| SMILES | Cc1cc(Br)cc([C@@H](N)CCCN)c1F |
| InChI | InChI=1S/C11H16BrFN2/c1-7-5-8(12)6-9(11(7)13)10(15)3-2-4-14/h5-6,10H,2-4,14-15H2,1H3/t10-/m0/s1 |
| InChIKey | ZPTBPCGHLRAOQV-JTQLQIEISA-N |
| XLogP | 2.64 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |