C11H13BrFNO2 — CID 117468252
4-amino-4-(5-bromo-2-fluoro-3-methylphenyl)butanoic acid (PubChem CID 117468252) has the molecular formula C11H13BrFNO2 and a molecular weight of 290.13 g/mol. Its IUPAC name is 4-amino-4-(5-bromo-2-fluoro-3-methylphenyl)butanoic acid.
| Compound Name | 4-amino-4-(5-bromo-2-fluoro-3-methylphenyl)butanoic acid |
|---|---|
| PubChem CID | 117468252 |
| Molecular Formula | C11H13BrFNO2 |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 4-amino-4-(5-bromo-2-fluoro-3-methylphenyl)butanoic acid |
| SMILES | Cc1cc(Br)cc(C(N)CCC(=O)O)c1F |
| InChI | InChI=1S/C11H13BrFNO2/c1-6-4-7(12)5-8(11(6)13)9(14)2-3-10(15)16/h4-5,9H,2-3,14H2,1H3,(H,15,16) |
| InChIKey | QBVQCDGZGFVKEZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |