C12H16FNO3 — CID 84800902
4-amino-4-(2-fluoro-5-methoxy-3-methylphenyl)butanoic acid (PubChem CID 84800902) has the molecular formula C12H16FNO3 and a molecular weight of 241.26 g/mol. Its IUPAC name is 4-amino-4-(2-fluoro-5-methoxy-3-methylphenyl)butanoic acid.
| Compound Name | 4-amino-4-(2-fluoro-5-methoxy-3-methylphenyl)butanoic acid |
|---|---|
| PubChem CID | 84800902 |
| Molecular Formula | C12H16FNO3 |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 4-amino-4-(2-fluoro-5-methoxy-3-methylphenyl)butanoic acid |
| SMILES | COc1cc(C)c(F)c(C(N)CCC(=O)O)c1 |
| InChI | InChI=1S/C12H16FNO3/c1-7-5-8(17-2)6-9(12(7)13)10(14)3-4-11(15)16/h5-6,10H,3-4,14H2,1-2H3,(H,15,16) |
| InChIKey | UMEDWPDFDLKAOS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |