C12H15ClFNO4 — CID 117471133
4-amino-4-(5-chloro-4-fluoro-2,3-dimethoxyphenyl)butanoic acid (PubChem CID 117471133) has the molecular formula C12H15ClFNO4 and a molecular weight of 291.71 g/mol. Its IUPAC name is 4-amino-4-(5-chloro-4-fluoro-2,3-dimethoxyphenyl)butanoic acid.
| Compound Name | 4-amino-4-(5-chloro-4-fluoro-2,3-dimethoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 117471133 |
| Molecular Formula | C12H15ClFNO4 |
| Molecular Weight | 291.71 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 4-amino-4-(5-chloro-4-fluoro-2,3-dimethoxyphenyl)butanoic acid |
| SMILES | COc1c(C(N)CCC(=O)O)cc(Cl)c(F)c1OC |
| InChI | InChI=1S/C12H15ClFNO4/c1-18-11-6(8(15)3-4-9(16)17)5-7(13)10(14)12(11)19-2/h5,8H,3-4,15H2,1-2H3,(H,16,17) |
| InChIKey | JQYGTTJSEQNNTJ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.71 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |