C11H13ClFNO4 — CID 117445111
3-amino-3-(5-chloro-4-fluoro-2,3-dimethoxyphenyl)propanoic acid (PubChem CID 117445111) has the molecular formula C11H13ClFNO4 and a molecular weight of 277.68 g/mol. Its IUPAC name is 3-amino-3-(5-chloro-4-fluoro-2,3-dimethoxyphenyl)propanoic acid.
| Compound Name | 3-amino-3-(5-chloro-4-fluoro-2,3-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117445111 |
| Molecular Formula | C11H13ClFNO4 |
| Molecular Weight | 277.68 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 3-amino-3-(5-chloro-4-fluoro-2,3-dimethoxyphenyl)propanoic acid |
| SMILES | COc1c(C(N)CC(=O)O)cc(Cl)c(F)c1OC |
| InChI | InChI=1S/C11H13ClFNO4/c1-17-10-5(7(14)4-8(15)16)3-6(12)9(13)11(10)18-2/h3,7H,4,14H2,1-2H3,(H,15,16) |
| InChIKey | ALKSIRNYZKXLLW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.68 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |