3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid

C10H10F3NO3 — CID 117115911

IUPAC3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid
SMILESCOc1c(F)c(F)cc(C(N)CC(=O)O)c1F
InChIInChI=1S/C10H10F3NO3/c1-17-10-8(12)4(2-5(11)9(10)13)6(14)3-7(15)16/h2,6H,3,14H2,1H3,(H,15,16)
InChIKeyVWZQBLGHIRSLIS-UHFFFAOYSA-N
MW249.19 g/mol
LogP1.59
Rot. Bonds4

About 3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid

3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid (PubChem CID 117115911) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is 3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid.

Molecular Properties

Compound Name3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid
PubChem CID117115911
Molecular FormulaC10H10F3NO3
Molecular Weight249.19 g/mol
Exact Mass249.06
IUPAC Name3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid
SMILESCOc1c(F)c(F)cc(C(N)CC(=O)O)c1F
InChIInChI=1S/C10H10F3NO3/c1-17-10-8(12)4(2-5(11)9(10)13)6(14)3-7(15)16/h2,6H,3,14H2,1H3,(H,15,16)
InChIKeyVWZQBLGHIRSLIS-UHFFFAOYSA-N
XLogP1.59
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.19
LogP ≤ 51.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid?
The IUPAC name of 3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid (CID 117115911) is 3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid.
What is the SMILES notation for 3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid?
The canonical SMILES for 3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid is COc1c(F)c(F)cc(C(N)CC(=O)O)c1F.
What is the InChIKey of 3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid?
The InChIKey is VWZQBLGHIRSLIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO3/c1-17-10-8(12)4(2-5(11)9(10)13)6(14)3-7(15)16/h2,6H,3,14H2,1H3,(H,15,16).
What are the key properties of 3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid?
3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid has a molecular weight of 249.19 g/mol, XLogP of 1.59, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(2,4,5-trifluoro-3-methoxyphenyl)propanoic acid is sourced from PubChem (CID 117115911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).