C11H14ClNO4 — CID 117403332
4-amino-4-(2-chloro-4-hydroxy-5-methoxyphenyl)butanoic acid (PubChem CID 117403332) has the molecular formula C11H14ClNO4 and a molecular weight of 259.69 g/mol. Its IUPAC name is 4-amino-4-(2-chloro-4-hydroxy-5-methoxyphenyl)butanoic acid.
| Compound Name | 4-amino-4-(2-chloro-4-hydroxy-5-methoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 117403332 |
| Molecular Formula | C11H14ClNO4 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 4-amino-4-(2-chloro-4-hydroxy-5-methoxyphenyl)butanoic acid |
| SMILES | COc1cc(C(N)CCC(=O)O)c(Cl)cc1O |
| InChI | InChI=1S/C11H14ClNO4/c1-17-10-4-6(7(12)5-9(10)14)8(13)2-3-11(15)16/h4-5,8,14H,2-3,13H2,1H3,(H,15,16) |
| InChIKey | ZSKVXKNDNKLGSM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |