C14H20ClNO4 — CID 43447011
6-amino-6-(2-chloro-4,5-dimethoxyphenyl)hexanoic acid (PubChem CID 43447011) has the molecular formula C14H20ClNO4 and a molecular weight of 301.77 g/mol. Its IUPAC name is 6-amino-6-(2-chloro-4,5-dimethoxyphenyl)hexanoic acid.
| Compound Name | 6-amino-6-(2-chloro-4,5-dimethoxyphenyl)hexanoic acid |
|---|---|
| PubChem CID | 43447011 |
| Molecular Formula | C14H20ClNO4 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 6-amino-6-(2-chloro-4,5-dimethoxyphenyl)hexanoic acid |
| SMILES | COc1cc(Cl)c(C(N)CCCCC(=O)O)cc1OC |
| InChI | InChI=1S/C14H20ClNO4/c1-19-12-7-9(10(15)8-13(12)20-2)11(16)5-3-4-6-14(17)18/h7-8,11H,3-6,16H2,1-2H3,(H,17,18) |
| InChIKey | AENMTNSWOVEBRL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|