C15H22BrNO4 — CID 105056901
methyl 6-amino-6-(4-bromo-2,5-dimethoxyphenyl)hexanoate (PubChem CID 105056901) has the molecular formula C15H22BrNO4 and a molecular weight of 360.25 g/mol. Its IUPAC name is methyl 6-amino-6-(4-bromo-2,5-dimethoxyphenyl)hexanoate.
| Compound Name | methyl 6-amino-6-(4-bromo-2,5-dimethoxyphenyl)hexanoate |
|---|---|
| PubChem CID | 105056901 |
| Molecular Formula | C15H22BrNO4 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | methyl 6-amino-6-(4-bromo-2,5-dimethoxyphenyl)hexanoate |
| SMILES | COC(=O)CCCCC(N)c1cc(OC)c(Br)cc1OC |
| InChI | InChI=1S/C15H22BrNO4/c1-19-13-9-11(16)14(20-2)8-10(13)12(17)6-4-5-7-15(18)21-3/h8-9,12H,4-7,17H2,1-3H3 |
| InChIKey | KKXGXFWRHZBPEJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|