C12H19BrClNO3 — CID 171214742
(4R)-4-amino-4-(4-bromo-2,5-dimethoxyphenyl)butan-1-ol;hydrochloride (PubChem CID 171214742) has the molecular formula C12H19BrClNO3 and a molecular weight of 340.65 g/mol. Its IUPAC name is (4R)-4-amino-4-(4-bromo-2,5-dimethoxyphenyl)butan-1-ol;hydrochloride.
| Compound Name | (4R)-4-amino-4-(4-bromo-2,5-dimethoxyphenyl)butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171214742 |
| Molecular Formula | C12H19BrClNO3 |
| Molecular Weight | 340.65 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | (4R)-4-amino-4-(4-bromo-2,5-dimethoxyphenyl)butan-1-ol;hydrochloride |
| SMILES | COc1cc([C@H](N)CCCO)c(OC)cc1Br.Cl |
| InChI | InChI=1S/C12H18BrNO3.ClH/c1-16-11-7-9(13)12(17-2)6-8(11)10(14)4-3-5-15;/h6-7,10,15H,3-5,14H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | NCSRDUHMJGEEQI-HNCPQSOCSA-N |
| XLogP | 2.66 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.65 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |