C10H14BrNO3 — CID 66516031
(2S)-2-amino-2-(5-bromo-2,4-dimethoxyphenyl)ethanol (PubChem CID 66516031) has the molecular formula C10H14BrNO3 and a molecular weight of 276.13 g/mol. Its IUPAC name is (2S)-2-amino-2-(5-bromo-2,4-dimethoxyphenyl)ethanol.
| Compound Name | (2S)-2-amino-2-(5-bromo-2,4-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 66516031 |
| Molecular Formula | C10H14BrNO3 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | (2S)-2-amino-2-(5-bromo-2,4-dimethoxyphenyl)ethanol |
| SMILES | COc1cc(OC)c([C@H](N)CO)cc1Br |
| InChI | InChI=1S/C10H14BrNO3/c1-14-9-4-10(15-2)7(11)3-6(9)8(12)5-13/h3-4,8,13H,5,12H2,1-2H3/t8-/m1/s1 |
| InChIKey | DWOOSHUSULVSAB-MRVPVSSYSA-N |
| XLogP | 1.46 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |