C13H19NO8 — CID 17389866
2-amino-2-(2,4,5-trimethoxyphenyl)ethanol;oxalic acid (PubChem CID 17389866) has the molecular formula C13H19NO8 and a molecular weight of 317.29 g/mol. Its IUPAC name is 2-amino-2-(2,4,5-trimethoxyphenyl)ethanol;oxalic acid.
| Compound Name | 2-amino-2-(2,4,5-trimethoxyphenyl)ethanol;oxalic acid |
|---|---|
| PubChem CID | 17389866 |
| Molecular Formula | C13H19NO8 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-amino-2-(2,4,5-trimethoxyphenyl)ethanol;oxalic acid |
| SMILES | COc1cc(OC)c(C(N)CO)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H17NO4.C2H2O4/c1-14-9-5-11(16-3)10(15-2)4-7(9)8(12)6-13;3-1(4)2(5)6/h4-5,8,13H,6,12H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | CKWWMQSBAOZKBR-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|