C12H20ClNO4 — CID 171219089
(3S)-3-amino-3-(2,4,5-trimethoxyphenyl)propan-1-ol;hydrochloride (PubChem CID 171219089) has the molecular formula C12H20ClNO4 and a molecular weight of 277.75 g/mol. Its IUPAC name is (3S)-3-amino-3-(2,4,5-trimethoxyphenyl)propan-1-ol;hydrochloride.
| Compound Name | (3S)-3-amino-3-(2,4,5-trimethoxyphenyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171219089 |
| Molecular Formula | C12H20ClNO4 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (3S)-3-amino-3-(2,4,5-trimethoxyphenyl)propan-1-ol;hydrochloride |
| SMILES | COc1cc(OC)c([C@@H](N)CCO)cc1OC.Cl |
| InChI | InChI=1S/C12H19NO4.ClH/c1-15-10-7-12(17-3)11(16-2)6-8(10)9(13)4-5-14;/h6-7,9,14H,4-5,13H2,1-3H3;1H/t9-;/m0./s1 |
| InChIKey | OEBSUTVRUWVKPF-FVGYRXGTSA-N |
| XLogP | 1.52 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |