C14H23NO4 — CID 66092622
4-amino-3-(2,4,5-trimethoxyphenyl)pentan-1-ol (PubChem CID 66092622) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-amino-3-(2,4,5-trimethoxyphenyl)pentan-1-ol.
| Compound Name | 4-amino-3-(2,4,5-trimethoxyphenyl)pentan-1-ol |
|---|---|
| PubChem CID | 66092622 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 4-amino-3-(2,4,5-trimethoxyphenyl)pentan-1-ol |
| SMILES | COc1cc(OC)c(C(CCO)C(C)N)cc1OC |
| InChI | InChI=1S/C14H23NO4/c1-9(15)10(5-6-16)11-7-13(18-3)14(19-4)8-12(11)17-2/h7-10,16H,5-6,15H2,1-4H3 |
| InChIKey | VCFQLJQBEAPWEA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |