C12H18BrNO4 — CID 83943810
2-amino-1-(2-bromo-4,5-dimethoxyphenyl)butane-1,4-diol (PubChem CID 83943810) has the molecular formula C12H18BrNO4 and a molecular weight of 320.18 g/mol. Its IUPAC name is 2-amino-1-(2-bromo-4,5-dimethoxyphenyl)butane-1,4-diol.
| Compound Name | 2-amino-1-(2-bromo-4,5-dimethoxyphenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 83943810 |
| Molecular Formula | C12H18BrNO4 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-amino-1-(2-bromo-4,5-dimethoxyphenyl)butane-1,4-diol |
| SMILES | COc1cc(Br)c(C(O)C(N)CCO)cc1OC |
| InChI | InChI=1S/C12H18BrNO4/c1-17-10-5-7(8(13)6-11(10)18-2)12(16)9(14)3-4-15/h5-6,9,12,15-16H,3-4,14H2,1-2H3 |
| InChIKey | FQHANCUIPVAQFE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |