C16H18BrNO3 — CID 62720028
2-amino-1-(2-bromo-4,5-dimethoxyphenyl)-2-phenylethanol (PubChem CID 62720028) has the molecular formula C16H18BrNO3 and a molecular weight of 352.23 g/mol. Its IUPAC name is 2-amino-1-(2-bromo-4,5-dimethoxyphenyl)-2-phenylethanol.
| Compound Name | 2-amino-1-(2-bromo-4,5-dimethoxyphenyl)-2-phenylethanol |
|---|---|
| PubChem CID | 62720028 |
| Molecular Formula | C16H18BrNO3 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 2-amino-1-(2-bromo-4,5-dimethoxyphenyl)-2-phenylethanol |
| SMILES | COc1cc(Br)c(C(O)C(N)c2ccccc2)cc1OC |
| InChI | InChI=1S/C16H18BrNO3/c1-20-13-8-11(12(17)9-14(13)21-2)16(19)15(18)10-6-4-3-5-7-10/h3-9,15-16,19H,18H2,1-2H3 |
| InChIKey | CRTDJPGKNKNPSN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |