C12H19ClN2O3 — CID 83943587
2,4-diamino-1-(2-chloro-4,5-dimethoxyphenyl)butan-1-ol (PubChem CID 83943587) has the molecular formula C12H19ClN2O3 and a molecular weight of 274.75 g/mol. Its IUPAC name is 2,4-diamino-1-(2-chloro-4,5-dimethoxyphenyl)butan-1-ol.
| Compound Name | 2,4-diamino-1-(2-chloro-4,5-dimethoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 83943587 |
| Molecular Formula | C12H19ClN2O3 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2,4-diamino-1-(2-chloro-4,5-dimethoxyphenyl)butan-1-ol |
| SMILES | COc1cc(Cl)c(C(O)C(N)CCN)cc1OC |
| InChI | InChI=1S/C12H19ClN2O3/c1-17-10-5-7(8(13)6-11(10)18-2)12(16)9(15)3-4-14/h5-6,9,12,16H,3-4,14-15H2,1-2H3 |
| InChIKey | SQLBVDBLPCDLRA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |