C10H13Cl2NO2 — CID 82297325
2-(2,5-dichloro-4-methoxyphenyl)-2-methoxyethanamine (PubChem CID 82297325) has the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. Its IUPAC name is 2-(2,5-dichloro-4-methoxyphenyl)-2-methoxyethanamine.
| Compound Name | 2-(2,5-dichloro-4-methoxyphenyl)-2-methoxyethanamine |
|---|---|
| PubChem CID | 82297325 |
| Molecular Formula | C10H13Cl2NO2 |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 2-(2,5-dichloro-4-methoxyphenyl)-2-methoxyethanamine |
| SMILES | COc1cc(Cl)c(C(CN)OC)cc1Cl |
| InChI | InChI=1S/C10H13Cl2NO2/c1-14-9-4-7(11)6(3-8(9)12)10(5-13)15-2/h3-4,10H,5,13H2,1-2H3 |
| InChIKey | ZULLAGQSHJKUGC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |