C11H15Cl2NO — CID 116914633
1-(2,5-dichloro-4-methoxyphenyl)-N,N-dimethylethanamine (PubChem CID 116914633) has the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. Its IUPAC name is 1-(2,5-dichloro-4-methoxyphenyl)-N,N-dimethylethanamine.
| Compound Name | 1-(2,5-dichloro-4-methoxyphenyl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 116914633 |
| Molecular Formula | C11H15Cl2NO |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 1-(2,5-dichloro-4-methoxyphenyl)-N,N-dimethylethanamine |
| SMILES | COc1cc(Cl)c(C(C)N(C)C)cc1Cl |
| InChI | InChI=1S/C11H15Cl2NO/c1-7(14(2)3)8-5-10(13)11(15-4)6-9(8)12/h5-7H,1-4H3 |
| InChIKey | PLMCBKMIRHFXIZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |