C9H11Cl2NO2 — CID 82291508
2-amino-1-(2,5-dichloro-4-methoxyphenyl)ethanol (PubChem CID 82291508) has the molecular formula C9H11Cl2NO2 and a molecular weight of 236.10 g/mol. Its IUPAC name is 2-amino-1-(2,5-dichloro-4-methoxyphenyl)ethanol.
| Compound Name | 2-amino-1-(2,5-dichloro-4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 82291508 |
| Molecular Formula | C9H11Cl2NO2 |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 2-amino-1-(2,5-dichloro-4-methoxyphenyl)ethanol |
| SMILES | COc1cc(Cl)c(C(O)CN)cc1Cl |
| InChI | InChI=1S/C9H11Cl2NO2/c1-14-9-3-6(10)5(2-7(9)11)8(13)4-12/h2-3,8,13H,4,12H2,1H3 |
| InChIKey | YEHFIIAERHOVMR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |