C14H18Cl2O3 — CID 103557615
1-(2,5-dichloro-4-methoxyphenyl)-2-(1-methoxycyclobutyl)ethanol (PubChem CID 103557615) has the molecular formula C14H18Cl2O3 and a molecular weight of 305.20 g/mol. Its IUPAC name is 1-(2,5-dichloro-4-methoxyphenyl)-2-(1-methoxycyclobutyl)ethanol.
| Compound Name | 1-(2,5-dichloro-4-methoxyphenyl)-2-(1-methoxycyclobutyl)ethanol |
|---|---|
| PubChem CID | 103557615 |
| Molecular Formula | C14H18Cl2O3 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 1-(2,5-dichloro-4-methoxyphenyl)-2-(1-methoxycyclobutyl)ethanol |
| SMILES | COc1cc(Cl)c(C(O)CC2(OC)CCC2)cc1Cl |
| InChI | InChI=1S/C14H18Cl2O3/c1-18-13-7-10(15)9(6-11(13)16)12(17)8-14(19-2)4-3-5-14/h6-7,12,17H,3-5,8H2,1-2H3 |
| InChIKey | ZWGIKVVARRUNEZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |