C15H20BrClO3 — CID 103557885
1-[1-bromo-2-(1-methoxycyclobutyl)ethyl]-3-chloro-2,4-dimethoxybenzene (PubChem CID 103557885) has the molecular formula C15H20BrClO3 and a molecular weight of 363.68 g/mol. Its IUPAC name is 1-[1-bromo-2-(1-methoxycyclobutyl)ethyl]-3-chloro-2,4-dimethoxybenzene.
| Compound Name | 1-[1-bromo-2-(1-methoxycyclobutyl)ethyl]-3-chloro-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 103557885 |
| Molecular Formula | C15H20BrClO3 |
| Molecular Weight | 363.68 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 1-[1-bromo-2-(1-methoxycyclobutyl)ethyl]-3-chloro-2,4-dimethoxybenzene |
| SMILES | COc1ccc(C(Br)CC2(OC)CCC2)c(OC)c1Cl |
| InChI | InChI=1S/C15H20BrClO3/c1-18-12-6-5-10(14(19-2)13(12)17)11(16)9-15(20-3)7-4-8-15/h5-6,11H,4,7-9H2,1-3H3 |
| InChIKey | QZSRWTXMNAFXNX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|