C11H14BrClOS — CID 103557841
2-[1-bromo-2-(1-methoxycyclobutyl)ethyl]-3-chlorothiophene (PubChem CID 103557841) has the molecular formula C11H14BrClOS and a molecular weight of 309.66 g/mol. Its IUPAC name is 2-[1-bromo-2-(1-methoxycyclobutyl)ethyl]-3-chlorothiophene.
| Compound Name | 2-[1-bromo-2-(1-methoxycyclobutyl)ethyl]-3-chlorothiophene |
|---|---|
| PubChem CID | 103557841 |
| Molecular Formula | C11H14BrClOS |
| Molecular Weight | 309.66 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | 2-[1-bromo-2-(1-methoxycyclobutyl)ethyl]-3-chlorothiophene |
| SMILES | COC1(CC(Br)c2sccc2Cl)CCC1 |
| InChI | InChI=1S/C11H14BrClOS/c1-14-11(4-2-5-11)7-8(12)10-9(13)3-6-15-10/h3,6,8H,2,4-5,7H2,1H3 |
| InChIKey | OIJBAWBLYCFGFN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|