C13H19ClO2S — CID 107359647
(3-chlorothiophen-2-yl)-(1-methoxycycloheptyl)methanol (PubChem CID 107359647) has the molecular formula C13H19ClO2S and a molecular weight of 274.81 g/mol. Its IUPAC name is (3-chlorothiophen-2-yl)-(1-methoxycycloheptyl)methanol.
| Compound Name | (3-chlorothiophen-2-yl)-(1-methoxycycloheptyl)methanol |
|---|---|
| PubChem CID | 107359647 |
| Molecular Formula | C13H19ClO2S |
| Molecular Weight | 274.81 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (3-chlorothiophen-2-yl)-(1-methoxycycloheptyl)methanol |
| SMILES | COC1(C(O)c2sccc2Cl)CCCCCC1 |
| InChI | InChI=1S/C13H19ClO2S/c1-16-13(7-4-2-3-5-8-13)12(15)11-10(14)6-9-17-11/h6,9,12,15H,2-5,7-8H2,1H3 |
| InChIKey | DPQFVONYLUMUAZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.81 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |